Matlystatin B
It is produced by the strain of Actinomadura atramentaria. It's a Type V collagenase inhibitor. It can inhibit type IV collagenase and type I collagenase with ID50 (μmol/L) of 1.43 and 1.2, respectively. It has anti-gram-positive bacteria effect.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-02309 |
| Pricing | Inquire |
| Cas | 140923-32-6 |
| Molecular Weight | 440.58 |
| Molecular Formula | C22H40N4O5 |
| Canonical SMILES | CCCCCC(CC(=O)NO)C(=O)N1C(CCCN1)C(=O)NC(C(C)CC)C(=O)CC |