Tolvaptan impurity 1
One of the impurities of Tolvaptan, which has been found to be a vasopressin V2 receptor antagonist and could probably be effective against hypertensive heart failure and could also be an effective renal protective agent.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1346599-56-1 |
| Pricing | Inquire |
| Cas | 1346599-56-1 |
| Molecular Weight | 478.94 |
| Molecular Formula | C26H23ClN2O5 |
| Canonical SMILES | CC1=CC=CC=C1C(=O)NC2=CC(=C(C=C2)C(=O)NC3=C(C=C(C=C3)Cl)C(=O)CCC(=O)O)C |