(S)-Posenacaftor sodium
(S)-Posenacaftor sodium is the S-enantiomer of Posenacaftor. Posenacaftor is a cystic fibrosis transmembrane regulator (CFTR) protein modulator that corrects the folding and trafficking of CFTR protein. It is used in cystic fibrosis (CF) studies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2095064-09-6 |
| Pricing | Inquire |
| Cas | 2095064-09-6 |
| Molecular Weight | 467.49 |
| Molecular Formula | C27H26NNaO5 |
| Canonical SMILES | CC1=C2C(=C(C=C1)OC(C)C3CCOCC3)C(=CC(=N2)C4=C(C5=CC=CC=C5O4)C)C(=O)[O-].[Na+] |