D-Homo B Derivative of Betamethasone Sodium Phosphate
D-Homo B Derivative of Betamethasone Sodium Phosphate is a highly efficacious corticosteroid, finding extensive application in the biomedical field for the research of diverse inflammatory cutaneous ailments, such as psoriasand eczema. Emerging as a derivative of Betamethasone Sodium Phosphate, this particular product showcases noteworthy anti-inflammatory attributes, significantly treating the cardinal symptoms encompassing erythema, pruritus and edema characterizing these dermal pathologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1201919-18-7 |
| Pricing | Inquire |
| Cas | 1201919-18-7 |
| Molecular Weight | 516.40 |
| Molecular Formula | C22H28FNa2O8P |
| Canonical SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C(C1=O)(COP(=O)([O-])[O-])O)C)O)F)C.[Na+].[Na+] |