Daclatasvir Impurity 6
Daclatasvir SRRS Isomer is an isomer of Daclatasvir, a compound that inhibits the HCV protein NS5A, and thus can be used as a drug candidate for the treatment of hepatitis C (HCV).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1009117-26-3 |
| Pricing | Inquire |
| Cas | 1009117-26-3 |
| Molecular Weight | 738.88 |
| Molecular Formula | C40H50N8O6 |
| Canonical SMILES | CC(C)C(C(=O)N1CCCC1C2=NC=C(N2)C3=CC=C(C=C3)C4=CC=C(C=C4)C5=CN=C(N5)C6CCCN6C(=O)C(C(C)C)NC(=O)OC)NC(=O)OC |