N-[(2R)-2-[2-(Hydroxyamino)-2-oxoethyl]-4-methyl-1-oxopentyl]-3-methyl-L-valyl-N-(2-aminoethyl)-L-alaninamide
TAPI 2 is an ADAM-17 (TACE) and matrix metalloprotease (MMP) inhibitor (Ki = 120 nM at ADAM-17). TAPI 2 sensitizes cancer stem cells to the lethal effects of 5-FU in vitro, and inhibits shedding of TNF-α from cell membranes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 689284-12-6 |
| Pricing | Inquire |
| Cas | 689284-12-6 |
| Molecular Weight | 415.54 |
| Molecular Formula | C19H37N5O5 |
| Canonical SMILES | CC(C)CC(CC(=O)NO)C(=O)NC(C(=O)NC(C)C(=O)NCCN)C(C)(C)C |