3-Nitrophenylboronic Acid
Reactant involved in: Copper-catalyzed arylation; Palladium-catalyzed decarboxylative coupling; Suzuki-Miyaura cross-coupling; Oxidative carbocyclization / arylation; Addition to arylpropargyl alcohols. Additionally used as a reactant for synthesizing biologically active molecules such as: Inhibitors of angiogenesis; Biaryl-olefins with antiproliferative activities Catalyzes ene carbocyclization of acetylenic dicarbonyl compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB007730 |
| Pricing | Inquire |
| Cas | 13331-27-6 |
| Molecular Weight | 166.93 |
| Molecular Formula | C6H6NO4B |
| Canonical SMILES | B(C1=CC(=CC=C1)[N+](=O)[O-])(O)O |