L-Carnitine-(methyl-d3) inner salt
L-Carnitine-(methyl-d3) inner salt is the labelled derivative of L-Carnitine. 2-Methylbutyryl-L-Carnitine is one of the acylcarnitines profiled from blood or plasma samples in the diagnosis of inborn errors of metabolism.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004415 |
| Pricing | Inquire |
| Cas | 126372-70-1 |
| Molecular Weight | 164.22 |
| Molecular Formula | C7H12D3NO3 |
| Canonical SMILES | C[N+](C)(C)CC(CC(=O)[O-])O |