Nepetoidin B
Nepetoidin B is a natural compound found in the stems of Elsholtiza bodinieri Vaniot, which displays anti-fungal and anti-bacterial effects. Study revealed that Nepetoidin B inhibited LPS-stimulated NO production possibly via modulation of iNOS mediated by MKP-5/NF-κB pathways in RAW 264.7 cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 55486-06-1 |
| Pricing | Inquire |
| Cas | 55486-06-1 |
| Molecular Weight | 314.293 |
| Molecular Formula | C17H14O6 |
| Canonical SMILES | C1=CC(=C(C=C1C=CC(=O)OC=CC2=CC(=C(C=C2)O)O)O)O |