Cyclosporin C
A minor analogue of the cyclosporin complex produced by a number of fungal species, including trichoderma, tolypocladium, fusarium, nectria and acremonium. It has the immunosuppressant activity but has been much less extensively investigated than the major analogue, cyclosporin A. Cyclosporin C is a broad-spectrum antifungal agent against filamentous phytopathogenic fungi but no activity against bacteria or yeasts.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05763 |
| Pricing | Inquire |
| Cas | 59787-61-0 |
| Molecular Weight | 1218.61 |
| Molecular Formula | C62H111N11O13 |
| Canonical SMILES | CC=CCC(C)C(C1C(=O)NC(C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C)C(C)O)O |