3'-O-(t-Butyldiphenylsilyl)-5'-O-(4,4'-dimethoxytrityl)thymidine
3'-O-(t-Butyldiphenylsilyl)-5'-O-(4,4'-dimethoxytrityl)thymidine, a highly complex and intricately designed nucleoside analog, serves as a paramount tool within the realm of biomedical research. Its profound versatility lies in its crucial role as a precursor in the synthesis of diverse modified oligonucleotides and nucleic acids. By embodying the epitome of precision through advanced molecular engineering techniques, this compound exhibits immense potential in the realm of biomedicine, thereby presenting promising therapeutic applications in combating viral infections and malignancies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 289681-49-8 |
| Pricing | Inquire |
| Cas | 289681-49-8 |
| Molecular Weight | 782.99 |
| Molecular Formula | C47H50N2O7Si |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O[Si](C6=CC=CC=C6)(C7=CC=CC=C7)C(C)(C)C |