3-O-Acetyl-1,2-O-isopropylidene-6-O-trityl-b-L-arabino-hexofuranos-5-ulose
3-O-Acetyl-1,2-O-isopropylidene-6-O-trityl-b-L-arabino-hexofuranos-5-ulose is a vital compound used in biomedicine for its potential therapeutic properties. This product can be utilized in the development of drugs aimed at treating various diseases and disorders. Its unique chemical structure makes it an important component in the research and advancement of medication targeting specific ailments, enhancing the potential for effective treatment outcomes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 109680-98-0 |
| Pricing | Inquire |
| Cas | 109680-98-0 |
| Molecular Weight | 502.56 |
| Molecular Formula | C30H30O7 |
| Canonical SMILES | CC(=O)OC1C2C(OC1C(=O)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)OC(O2)(C)C |