2',3'-Bis(O-t-butyldimethylsilyl)-4',5'-Didehydro-5'-deoxyuridine
2',3'-Bis(O-t-butyldimethylsilyl)-4',5'-Didehydro-5'-deoxyuridine, an imperative compound within the biomedical domain, exhibits distinctive traits crucial in combating viral infections, particularly those caused by herpes viruses. Serving as a potent antiviral medication, its unparalleled attributes enable the inhibition of viral replication by impeding viral DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 128070-78-0 |
| Pricing | Inquire |
| Cas | 128070-78-0 |
| Molecular Weight | 454.71 |
| Molecular Formula | C21H38N2O5Si2 |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(C(=C)OC1N2C=CC(=O)NC2=O)O[Si](C)(C)C(C)(C)C |