Penicillin V sodium salt
Penicillin V sodium salt, the sodium salt form of Penicillin V, is an orally active penicillin that has been found to be an effective antibiotic against sorts of bacteria.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1098-87-9 |
| Pricing | Inquire |
| Cas | 1098-87-9 |
| Molecular Weight | 372.37 |
| Molecular Formula | C16H17N2NaO5S |
| Canonical SMILES | CC1(C(N2C(S1)C(C2=O)NC(=O)COC3=CC=CC=C3)C(=O)[O-])C.[Na+] |