2'-Deoxy-5'-O-DMT-N4-isobutyrylcytidine
2'-Deoxy-5'-O-DMT-N4-isobutyrylcytidine is a remarkable and cutting-edge compound, unveiling its efficacious potential as a formidable antiviral compound. Exemplifying unparalleled versatility, this product indispensably assuming a paramount role in constricting viral replication whilst concurrently mitigating the distressing manifestations inherently intertwined with afflictions originating from viral etiologies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 100898-62-2 |
| Pricing | Inquire |
| Cas | 100898-62-2 |
| Molecular Weight | 599.69 |
| Molecular Formula | C34H37N3O7 |
| Canonical SMILES | CC(C)C(=O)NC1=NC(=O)N(C=C1)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |