Rp-8-PIP-cAMPS
Rp-8-PIP-cAMPS is a selective analogue of Rp-cAMPS, the protein kinase A inhibitor, preferring site B of cAK type II. It effects against mammalian cyclic nucleotide-dependent phosphodiesterases. Compared to Rp-cAMPS, it has more lipophilic and membrane-permeant properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 156816-36-3 |
| Pricing | Inquire |
| Cas | 156816-36-3 |
| Molecular Weight | 450.4 |
| Molecular Formula | C15H20N6O5PS ยท Na |
| Canonical SMILES | C1CCN(CC1)C2=NC3=C(N=CN=C3N2C4C(C5C(O4)COP(=S)(O5)[O-])O)N.[Na+] |