Lycojaponicuminol C
Lycojaponicuminol C, an organic compound extracted from natural sources, possesses intriguing antitumor effects. Preclinical investigations have demonstrated its modulating capacity over the carcinogenic progression of various types of tumors, including breast and colon. The molecular mechanisms behind its cytotoxicity involve impeding malignant proliferation and provoking programmed cell death in cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP7116 |
| Pricing | Inquire |
| Cas | 1651839-34-7 |
| Molecular Weight | 460.698 |
| Molecular Formula | C29H48O4 |
| Canonical SMILES | CC1(C2CCC(=C)C(C2(CCC1O)C)CCC3C4(CCC(C(C4CCC(=O)O3)(C)C)O)C)C |