2,5-Di-O-benzyl-3-deoxy-3-fluoro-b-D-ribofuranose
2,5-Di-O-benzyl-3-deoxy-3-fluoro-b-D-ribofuranose is a structurally modified synthetic derivative that has gained considerable attention as a prospective antiviral agent. Its potential usage as a therapeutic agent in the treatment of contemporarily prevalent RNA viruses such as HCV and SARS-CoV make it a significant molecule with undeniable biomedical significance. Specifically, this compound has been investigated as a nucleoside analogue for its ability to inhibit viral RNA replication through impeding the virus's RNA-dependent RNA polymerase.
Supplier | BOC Sciences |
---|---|
Product # | 123369-31-3 |
Pricing | Inquire |
Cas | 123369-31-3 |
Molecular Weight | 332.4 |
Molecular Formula | C19H21FO4 |
Canonical SMILES | C1=CC=C(C=C1)COCC2C(C(C(O2)O)OCC3=CC=CC=C3)F |