(R,R)-Ts-DENEB
(R,R)-Ts-DENEB (CAS# 1333981-84-2) is a catalyst used in asymmetric hydrogen transfer reactions, such as in the synthesis of 2-(1,2,3,4-tetrahydro-1-isoquinolyl)ethanol derivatives. (R,R)-Ts-DENEB is used to form hydrogen carrier systems, where the catalytic dehydrogenative coupling of methanol and 1,2-diamine is used to generate H2 without the production of CO2.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB057008 |
| Pricing | Inquire |
| Cas | 1333981-84-2 |
| Molecular Weight | 650.19 |
| Molecular Formula | C31H33ClN2O3RuS |
| Canonical SMILES | CC1=CC=C(C=C1)COCCNC(C2=CC=CC=C2)C(C3=CC=CC=C3)[N-]S(=O)(=O)C4=CC=C(C=C4)C.Cl[Ru+] |