Biotinoyl tripeptide-1
Biotinoyl tripeptide-1 is a peptide beneficial for hair conditioning. Biotinoyl tripeptide-1 is also used in anti-aging cosmetics. Biotinoyl tripeptide-1 is a tripeptide that combines vitamin H with the Matrikine series GHK. Biotinoyl tripeptide-1 can stimulate the synthesis of collagen IV and laminin 5, and fix hair in the dermal hair follicle to prevent hair loss.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010782 |
| Pricing | Inquire |
| Cas | 299157-54-3 |
| Molecular Weight | 566.67 |
| Molecular Formula | C24H38N8O6S |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)NCC(=O)NC(CC3=CN=CN3)C(=O)NC(CCCCN)C(=O)O)NC(=O)N2 |