Acid orange 24
Acid Orange 24, a synthetic dye prevalent in the biomedical industry, is integral for cell staining and histological examination. Its role extends to the pharmaceutical sector, supporting drug formulations and cancer treatment research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1320-07-6 |
| Pricing | Inquire |
| Cas | 1320-07-6 |
| Molecular Weight | 448.43 |
| Molecular Formula | C20H17N4NaO5S |
| Canonical SMILES | CC1=CC(=C(C=C1)NN=C2C(=O)C=CC(=NNC3=CC=C(C=C3)S(=O)(=O)[O-])C2=O)C.[Na+] |