DMTr-2'-O-4'-C-ethylene-rU-3'-CE-Phosphoramidite
DMTr-2'-O-4'-C-ethylene-rU-3'-CE-Phosphoramidite, utilized in oligonucleotide synthesis, exhibits increased stability and binding properties owing to the incorporation of an ethylene linker at the 2'-O and 4'-C positions of uridine (rU). The presence of a cyanoethyl (CE) group at the 3'-end facilitates efficient coupling reactions during solid-phase synthesis. It is particularly useful in the generation of modified RNA molecules for various biological applications, such as RNA interference (RNAi) and antisense therapy.
Supplier | BOC Sciences |
---|---|
Product # | BRP-00598 |
Pricing | Inquire |
Cas | 287737-49-9 |
Molecular Weight | 772.84 |
Molecular Formula | C41H49N4O9P |
Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1C2C(OC1(CCO2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)N6C=CC(=O)NC6=O |