DOTATATE acetate
DOTATATE acetate is a radiolabeled somatostatin analog used in medical imaging and therapy for neuroendocrine tumors (NETs). DOTATATE acetate is a peptide derivative that binds selectively to somatostatin receptors (mainly subtype 2), which are overexpressed on the surface of neuroendocrine tumor cells. This allows for specific targeting of these tumors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-010211 |
| Pricing | Inquire |
| Cas | 177943-89-4 |
| Molecular Weight | 1435.63 (free base) |
| Molecular Formula | C65H90N14O19S2.xC2H4O2 |
| Canonical SMILES | CC(C1C(=O)NC(CSSCC(C(=O)NC(C(=O)NC(C(=O)NC(C(=O)N1)CCCCN)CC2=CNC3=CC=CC=C32)CC4=CC=C(C=C4)O)NC(=O)C(CC5=CC=CC=C5)NC(=O)CN6CCN(CCN(CCN(CC6)CC(=O)O)CC(=O)O)CC(=O)O)C(=O)NC(C(C)O)C(=O)O)O |