5-Aminomethyl-2',3'-di-O-isopropylidene 2-thiouridine
5-Aminomethyl-2',3'-di-O-isopropylidene 2-thiouridine is a highly intricate and multifaceted compound widely employed in esteemed scientific investigations.This remarkable compound manifests significant promise in research of an array of ailments, such as cancer and viral afflictions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1428903-07-4 |
| Pricing | Inquire |
| Cas | 1428903-07-4 |
| Molecular Weight | 329.37 |
| Molecular Formula | C13H19N3O5S |
| Canonical SMILES | CC1(OC2C(OC(C2O1)N3C=C(C(=O)NC3=S)CN)CO)C |