Methyl 6-deoxy-3,4-O-isopropylidene-2-O-methyl-a-D-galactopyranoside
Methyl 6-deoxy-3,4-O-isopropylidene-2-O-methyl-a-D-galactopyranoside stands as a pivotal chemical entity harnessed within the biomedical sector. Renowned for its distinctive molecular arrangement, it offers itself as an indispensable tool in diverse investigative contexts, with a particular emphasis on the inception of pharmaceutical agents aimed to combat highly specific pathologies
| Supplier | BOC Sciences |
|---|---|
| Product # | 74135-23-2 |
| Pricing | Inquire |
| Cas | 74135-23-2 |
| Molecular Weight | 232.28 |
| Molecular Formula | C11H20O5 |
| Canonical SMILES | CC1C2C(C(C(O1)OC)OC)OC(O2)(C)C |