5-Hydroxymethyl-2'-deoxyuridine-5'-Triphosphate
5-Hydroxymethyl-2'-deoxyuridine-5'-Triphosphate is a pivotal compound, holding paramount significance in DNA labeling and sequencing endeavors. Functioning as a modified nucleotide triphosphate, it exhibits competencies in assimilating within DNA during the process of polymerization, thereby facilitating the identification of DNA alterations. This invaluable compound assumes a critical role in the comprehensive exploration of epigenetic modifications and the consequential impact of oxidative stress on DNA replication and repair pathways.
| Supplier | BOC Sciences |
|---|---|
| Product # | 14167-70-5 |
| Pricing | Inquire |
| Cas | 14167-70-5 |
| Molecular Weight | 498.10 |
| Molecular Formula | C10H17N2O15P3 |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=O)NC2=O)CO)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |