1-Adamantyl Acrylate
1-Adamantyl Acrylate is a specialized biomedical compound. Primarily used in medicinal chemistry and pharmaceutical research, it is key in the synthesis of drugs treating diseases like cancer and neurological disorders within the biomedical industry.
| Supplier | BOC Sciences |
|---|---|
| Product # | 121601-93-2 |
| Pricing | Inquire |
| Cas | 121601-93-2 |
| Molecular Weight | 206.28 |
| Molecular Formula | C13H18O2 |
| Canonical SMILES | C=CC(=O)OC12CC3CC(C1)CC(C3)C2 |