2-Amino-6-chloro-9-(3-deoxy-beta-D-ribofuanosyl)-9H-purine
2-Amino-6-chloro-9-(3-deoxy-beta-D-ribofuanosyl)-9H-purine is an antiviral drug used to treat chronic Hepatitis B and C, as well as HIV infections. It works by inhibiting viral DNA synthesis, therefore preventing virus replication and spread within the body.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1055035-48-7 |
| Pricing | Inquire |
| Cas | 1055035-48-7 |
| Molecular Weight | 285.69 |
| Molecular Formula | C10H12ClN5O3 |
| Canonical SMILES | C1C(OC(C1O)N2C=NC3=C2N=C(N=C3Cl)N)CO |