trans-4-(3-Benzo[b]thienylmethyl)-L-proline hydrochloride
trans-4-(3-Benzo[b]thienylmethyl)-L-proline hydrochloride is an intriguing compound with promising implications as a prolyl endopeptidase inhibitor for potential therapeutic applications in addressing the complexities of Alzheimer's disease and its associated pathophysiological mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-006986 |
| Pricing | Inquire |
| Cas | 1049753-14-1 |
| Molecular Weight | 297.79 |
| Molecular Formula | C14H16ClNO2S |
| Canonical SMILES | C1C(CNC1C(=O)O)CC2=CSC3=CC=CC=C32.Cl |