5'-DMT-2'-O-TBDMS-PseudoUridine
5'-DMT-2'-O-TBDMS-PseudoUridine, a modified nucleoside of immense significance, serves as a fundamental constituent in the synthetic construction of altered RNA molecules. Its pseudouridine backbone modification and safeguarded functional groups contribute significantly to its pivotal role as an indispensable instrument in the advancement of RNA-centric therapeutics. This distinctive compound manifests immense potential in the realm of gene therapy and drug delivery systems, exemplifying its ability to target a wide array of ailments such as cancer, viral infections, and genetic anomalies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 144429-56-1 |
| Pricing | Inquire |
| Cas | 144429-56-1 |
| Molecular Weight | 660.83 |
| Molecular Formula | C36H44N2O8Si |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(C(OC1C2=CNC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)O |