5-Iodo-dCTP
5-Iodo-dCTP is a crucial tool in biomedicine used for various applications. It serves as a labeled nucleotide analog and finds extensive use in DNA sequencing and labeling techniques. This product enables precise detection and identification of specific DNA sequences, aiding in genetic research, disease diagnostics, and drug development. It is commonly employed in studies related to cancer mutations and genetic disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31747-59-8 |
| Pricing | Inquire |
| Cas | 31747-59-8 |
| Molecular Weight | 593.05 (free acid) |
| Molecular Formula | C9H15N3O13P3I (free acid) |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=NC2=O)N)I)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O |