Phenyl 2-acetamido-2-deoxy-b-D-glucopyranoside
Phenyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a versatile compound widely used in the biomedical industry. It serves as a crucial component in the synthesis of various drugs and therapies aimed at treating diseases such as bacterial infections, inflammation, and cancer. This compound exhibits potent biological activities that make it an indispensable tool in biomedical research and drug development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5574-80-1 |
| Pricing | Inquire |
| Cas | 5574-80-1 |
| Molecular Weight | 297.30 |
| Molecular Formula | C14H19NO6 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2=CC=CC=C2)CO)O)O |