1-Bromo-4-fluoronaphthalene
1-Bromo-4-fluoronaphthalene (CAS# 341-41-3) is the starting material for the synthesis of Fluorobenzo[c]fluoren (F588435) which is a polycyclic aromatic hydrocarbon used in materials science extensively due to utility in organic electronics, light emitting diodes and solar cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 341-41-3 |
| Pricing | Inquire |
| Cas | 341-41-3 |
| Molecular Weight | 225.06 |
| Molecular Formula | C10H6BrF |
| Canonical SMILES | C1=CC=C2C(=C1)C(=CC=C2Br)F |