S 32212 hydrochloride
S 32212 hydrochloride is an inverse agonist of 5-HT2C receptors (pKi = 8.18 at human 5-HT2C INI, receptors), and also acts as an antagonist of human α2-adrenoceptors. S 32212 exhibits negligible affinity for α1A-adrenoceptors, histamine H1 receptors and muscarinic M1 receptors. S 32212 is identified as a potential antidepressant.
| Supplier | BOC Sciences |
|---|---|
| Product # | 847871-78-7 |
| Pricing | Inquire |
| Cas | 847871-78-7 |
| Molecular Weight | 452.98 |
| Molecular Formula | C25H28N4O2.HCl |
| Canonical SMILES | CN1CCN(CC1)C2=C(C=CC(=C2)NC(=O)N3CCC4=C3C=CC5=CC=CC=C45)OC.Cl |