Murrastinine C
Murrastinine C is an exceptionally robust alkaloid derived from the bark of Murraya koenigii exhibiting potential for studying cancer. Its remarkable attributes have been identified to effectively impede the proliferation of diverse neoplastic cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP0766 |
| Pricing | Inquire |
| Cas | 20105-20-8 |
| Molecular Weight | 277.32 |
| Molecular Formula | C18H15NO2 |
| Canonical SMILES | CC1(C=CC2=C(O1)C=CC3=C2NC4=C3C=C(C=C4)C=O)C |