N-Acetyl-5'-O-tritylcytidine
N-Acetyl-5'-O-tritylcytidine, a nucleoside analog commonly utilized in antiviral research, boasts potential as an agent to tackle various viral diseases, such as hepatitis B and C. Its selective inhibition of viral DNA synthesis is sparking interest in possible future drug development, and serves as a subject of study to further investigate antiviral drug efficacy and mechanisms of action.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31085-52-6 |
| Pricing | Inquire |
| Cas | 31085-52-6 |
| Molecular Weight | 527.58 |
| Molecular Formula | C30H29N3O6 |
| Canonical SMILES | CC(=O)NC1=NC(=O)N(C=C1)C2C(C(C(O2)COC(C3=CC=CC=C3)(C4=CC=CC=C4)C5=CC=CC=C5)O)O |