RD 162
RD 162 is an orally bioactive and second-generation antagonist of androgen receptor (AR). It inhibits 18F-FDHT binding to AR in human prostate cancer cells thus is used for the treatment of advanced prostate cancer.
| Supplier | BOC Sciences |
|---|---|
| Product # | 915087-27-3 |
| Pricing | Inquire |
| Cas | 915087-27-3 |
| Molecular Weight | 476.45 |
| Molecular Formula | C22H16F4N4O2S |
| Canonical SMILES | CNC(=O)C1=C(C=C(C=C1)N2C(=S)N(C(=O)C23CCC3)C4=CC(=C(C=C4)C#N)C(F)(F)F)F |