3-Deoxy-D-arabino-heptulosonate 7-phosphate
3-Deoxy-D-arabino-heptulosonate 7-Phosphate is an intermediate useful in the synthesis of 3-Deoxy-D-arabinoheptulosonic Acid 7-Phosphate Disodium Salt, which stands at the beginning of the enzyme-catalyzed cascade that starts with this seven-carbon carbohydrate and ends with the aromatic amino acids phenylalanine, tyrosine, and tryptophan.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2627-73-8 |
| Pricing | Inquire |
| Cas | 2627-73-8 |
| Molecular Weight | 288.15 |
| Molecular Formula | C7H13O10P |
| Canonical SMILES | O=C(O)C(=O)CC(O)C(O)C(O)COP(=O)(O)O |