5-(Trifluoromethyl)cytidine
5-(Trifluoromethyl)cytidine, a remarkable antiviral compound, demonstrates exceptional potency in research of RNA virus-induced infections. This compound can be used in flaviviruses and picornaviruses, including notorious hepatitis C and poliovirus. Its mechanism of action involves the inhibition of viral replication and cellular protein research and development.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76514-02-8 |
| Pricing | Inquire |
| Cas | 76514-02-8 |
| Molecular Weight | 311.21 |
| Molecular Formula | C10H12F3N3O5 |
| Canonical SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)O)O)N)C(F)(F)F |