Biotin CE Phosphoramidite
Biotin CE Phosphoramidite is a biomolecule unparalleled in its intricacy and complexity, crucial to the synthesis of DNA strands. This exceptional product, with its multifarious biomedical applications, has been meticulously crafted to facilitate the generation of oligonucleotide probes tailored to the detection of malignant phenomena like cancer; further enhanced by its ability to expedite drug development studies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 147190-34-9 |
| Pricing | Inquire |
| Cas | 147190-34-9 |
| Molecular Weight | 876.11 |
| Molecular Formula | C47H66N5O7PS |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OCC(CCCCNC(=O)CCCCC1C2C(CS1)NC(=O)N2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |