Cefathiamidine Impurity 1
An analog of glutaryl-7-amino cephalosporanic acid (GL-7-ACA). Can inhibit and specifically alkylate GL-7-ACA acylase (C130) from Pseudomonas sp.130 by forming a carbon-carbon bond between BA-7-ACA and the C-2 on indole ring of Trp-β4 residue of C130.
| Supplier | BOC Sciences |
|---|---|
| Product # | 26973-80-8 |
| Pricing | Inquire |
| Cas | 26973-80-8 |
| Molecular Weight | 393.22 |
| Molecular Formula | C12H13BrN2O6S |
| Canonical SMILES | CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CBr)SC1)C(=O)O |