(7-Methoxy-5-methylbenzo[b]thiophen-2-yl)boronic acid
(7-Methoxy-5-methylbenzo[b]thiophen-2-yl)boronic acid is a vital chemical entity employed within the biomedical sector for the creation of innovative pharmaceuticals aimed at combating various ailments including cancer and inflammatory conditions. Its significance lies in its pivotal role as a foundational component in the fabrication of medications with promising healing properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1443531-60-9 |
| Pricing | Inquire |
| Cas | 1443531-60-9 |
| Molecular Weight | 222.06 |
| Molecular Formula | C10H11BO3S |
| Canonical SMILES | B(C1=CC2=C(S1)C(=CC(=C2)C)OC)(O)O |