Guanylyl-3'-5'-uridine ammonium salt
Guanylyl-3'-5'-uridine ammonium salt is an essential biomedical ingredient, playing a pivotal role in mRNA synthesand facilitates genetic information translation. Its diverse applications span the biomedical field, notably encompassing mRNA-related disease researchs and the advancement of mRNA-based therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | 41547-83-5 |
| Pricing | Inquire |
| Cas | 41547-83-5 |
| Molecular Weight | 606.45 |
| Molecular Formula | C19H24N7O13P·NH3 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OC3C(OC(C3O)N4C=NC5=C4N=C(NC5=O)N)CO)O)O.N |