6-O-(N-Acetyl-α-neuraminosyl)-D-galactose
6-O-(N-Acetyl-α-neuraminosyl)-D-galactose is an indispensable moiety prevailing in the biomedical realm, finding extensive employment in synthesizing diverse pharmacological compounds. Its pivotal function in research of anomalous glycosylation-linked afflictions, encompassing metabolic disorders, hereditary conditions and select neoplasms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 35259-23-5 |
| Pricing | Inquire |
| Cas | 35259-23-5 |
| Molecular Weight | 471.41 |
| Molecular Formula | C17H29NO14 |
| Canonical SMILES | CC(=O)NC1C(CC(OC1C(C(CO)O)O)(C(=O)O)OCC(C(C(C(C=O)O)O)O)O)O |