5'-O-Dmt-thymidine 3'-o-succinate triethylammonium salt
5'-O-Dmt-thymidine 3'-o-succinate triethylammonium salt is an influential nucleoside analogue extensively utilized in the biomedical research community, exhibiting immense potential for the investigation of intricate genetic ailments, including cancer, by virtue of its ability to impede DNA and RNA enhancement.
| Supplier | BOC Sciences |
|---|---|
| Product # | 402944-22-3 |
| Pricing | Inquire |
| Cas | 402944-22-3 |
| Molecular Weight | 769.888 |
| Molecular Formula | C43H51N3O10 |
| Canonical SMILES | CCN(CC)CC.CC1=CN(C(=O)NC1=O)C2CC(C(O2)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC)OC(=O)CCC(=O)O |