5-Bromo-6-chloro-1H-indol-3-yl-a-D-mannopyranoside
5-Bromo-6-chloro-1H-indol-3-yl-a-D-mannopyranoside is a formidable compound exhibiting promising outcomes in tackling relentless drug-resistant strains. Emanating an aura of boundless potential, this compound stands poised to revolutionize the research landscape for intractable drug-resistant strains.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1384197-50-5 |
| Pricing | Inquire |
| Cas | 1384197-50-5 |
| Molecular Weight | 408.63 |
| Molecular Formula | C14H15BrClNO6 |
| Canonical SMILES | C1=C2C(=CC(=C1Br)Cl)NC=C2OC3C(C(C(C(O3)CO)O)O)O |