2-Deoxy-2-fluoro-D-glucose 6-phosphate barium salt
2-Deoxy-2-fluoro-D-glucose 6-phosphate barium salt is used as a radiopharmaceutical tracer for PET imaging in the diagnosis and management of various cancers. It is a glucose analog that is taken up by cancer cells in higher amounts than normal cells and can help identify tumors and monitor disease progression.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40871-47-4 |
| Pricing | Inquire |
| Cas | 40871-47-4 |
| Molecular Weight | 397.44 |
| Molecular Formula | C6H10FO8P.Ba |
| Canonical SMILES | C(C(C(C(C(C=O)F)O)O)O)OP(=O)(O)O |