2',3'-Didehydro-2',3'-dideoxy-5'-acetate inosine
2',3'-Didehydro-2',3'-dideoxy-5'-acetate inosine is a biomedical compound renowned for its remarkable antiviral attributes with widespread application in the research of therapeutic interventions. It has profound inhibitory influences on viral replication, serving as a research weapon against formidable viral infections such as hepatitis C and HIV.
| Supplier | BOC Sciences |
|---|---|
| Product # | 130676-57-2 |
| Pricing | Inquire |
| Cas | 130676-57-2 |
| Molecular Weight | 276.25 |
| Molecular Formula | C12H12N4O4 |
| Canonical SMILES | CC(=O)OCC1C=CC(O1)N2C=NC3=C2N=CNC3=O |