6-Amino-9-(1-deoxy-b-D-psicofuranosyl)purine
6-Amino-9-(1-deoxy-b-D-psicofuranosyl)purine is a vital product in the biomedical industry. It is used in the treatment of various diseases, including viral infections and cancer. This compound exhibits antiviral properties by inhibiting viral replication. Furthermore, it possesses anti-cancer activity by interfering with DNA synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16848-12-7 |
| Pricing | Inquire |
| Cas | 16848-12-7 |
| Molecular Weight | 281.27 |
| Molecular Formula | C11H15N5O4 |
| Canonical SMILES | CC1(C(C(C(O1)CO)O)O)N2C=NC3=C(N=CN=C32)N |