TC-G 1003
TC-G 1003 is a potent and high affinity somatostatin sst2 receptor agonist (Ki = 0.025 nM). TC-G 1003 exhibits an inhibitory effect on growth hormone secretion and attenuates laser-induced ocular neovascular lesion size in rats.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1021912-42-4 |
| Pricing | Inquire |
| Cas | 1021912-42-4 |
| Molecular Weight | 432.94 |
| Molecular Formula | C26H25ClN2O2 |
| Canonical SMILES | CC1=CC(=CC(=C1)C2=C(C3=CC(=C(C=C3N=C2)Cl)C4=CC(=CC=C4)O)OCCCN)C |